C21H34O — CID 74218572
3-(4,8-dimethylpentadeca-3,7-dienyl)furan (PubChem CID 74218572) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is 3-(4,8-dimethylpentadeca-3,7-dienyl)furan.
| Compound Name | 3-(4,8-dimethylpentadeca-3,7-dienyl)furan |
|---|---|
| PubChem CID | 74218572 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 3-(4,8-dimethylpentadeca-3,7-dienyl)furan |
| SMILES | CCCCCCCC(C)=CCCC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C21H34O/c1-4-5-6-7-8-11-19(2)12-9-13-20(3)14-10-15-21-16-17-22-18-21/h12,14,16-18H,4-11,13,15H2,1-3H3 |
| InChIKey | DIRMOUDQVQZPRZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|