C24H36O — CID 54588647
3-[(3E,7E,11E)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]furan (PubChem CID 54588647) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is 3-[(3E,7E,11E)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]furan.
| Compound Name | 3-[(3E,7E,11E)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]furan |
|---|---|
| PubChem CID | 54588647 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 3-[(3E,7E,11E)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]furan |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C/CCc1ccoc1 |
| InChI | InChI=1S/C24H36O/c1-21(2)12-10-14-23(4)16-11-15-22(3)13-8-6-5-7-9-17-24-18-19-25-20-24/h5,7,12-13,16,18-20H,6,8-11,14-15,17H2,1-4H3/b7-5+,22-13+,23-16+ |
| InChIKey | KRGPLKLBHADPNV-BMONIJJTSA-N |
| XLogP | 7.97 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|