C29H44O — CID 123177359
3-(4,8,12,16-tetramethylhenicosa-3,7,11,15,19-pentaenyl)furan (PubChem CID 123177359) has the molecular formula C29H44O and a molecular weight of 408.67 g/mol. Its IUPAC name is 3-(4,8,12,16-tetramethylhenicosa-3,7,11,15,19-pentaenyl)furan.
| Compound Name | 3-(4,8,12,16-tetramethylhenicosa-3,7,11,15,19-pentaenyl)furan |
|---|---|
| PubChem CID | 123177359 |
| Molecular Formula | C29H44O |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 3-(4,8,12,16-tetramethylhenicosa-3,7,11,15,19-pentaenyl)furan |
| SMILES | CC=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C29H44O/c1-6-7-8-13-25(2)14-9-15-26(3)16-10-17-27(4)18-11-19-28(5)20-12-21-29-22-23-30-24-29/h6-7,14,16,18,20,22-24H,8-13,15,17,19,21H2,1-5H3 |
| InChIKey | DTUURYRRNOQTRS-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|