C28H42O — CID 123271436
3-(4,8,12,16-tetramethylicosa-3,7,11,15,18-pentaenyl)furan (PubChem CID 123271436) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is 3-(4,8,12,16-tetramethylicosa-3,7,11,15,18-pentaenyl)furan.
| Compound Name | 3-(4,8,12,16-tetramethylicosa-3,7,11,15,18-pentaenyl)furan |
|---|---|
| PubChem CID | 123271436 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | 3-(4,8,12,16-tetramethylicosa-3,7,11,15,18-pentaenyl)furan |
| SMILES | CC=CCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C28H42O/c1-6-7-12-24(2)13-8-14-25(3)15-9-16-26(4)17-10-18-27(5)19-11-20-28-21-22-29-23-28/h6-7,13,15,17,19,21-23H,8-12,14,16,18,20H2,1-5H3 |
| InChIKey | MSCGVTLUHTXDEV-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|