C15H22O — CID 5316534
3-[(3E)-4,8-dimethylnona-3,7-dienyl]furan (PubChem CID 5316534) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-[(3E)-4,8-dimethylnona-3,7-dienyl]furan.
| Compound Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]furan |
|---|---|
| PubChem CID | 5316534 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]furan |
| SMILES | CC(C)=CCC/C(C)=C/CCc1ccoc1 |
| InChI | InChI=1S/C15H22O/c1-13(2)6-4-7-14(3)8-5-9-15-10-11-16-12-15/h6,8,10-12H,4-5,7,9H2,1-3H3/b14-8+ |
| InChIKey | LZBXPXAOYQVZEC-RIYZIHGNSA-N |
| XLogP | 4.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|