C30H48O — CID 123833340
3-(4,8,12,16,20-pentamethylhenicosa-3,7,11,15-tetraenyl)furan (PubChem CID 123833340) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is 3-(4,8,12,16,20-pentamethylhenicosa-3,7,11,15-tetraenyl)furan.
| Compound Name | 3-(4,8,12,16,20-pentamethylhenicosa-3,7,11,15-tetraenyl)furan |
|---|---|
| PubChem CID | 123833340 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | 3-(4,8,12,16,20-pentamethylhenicosa-3,7,11,15-tetraenyl)furan |
| SMILES | CC(=CCCC(C)=CCCc1ccoc1)CCC=C(C)CCC=C(C)CCCC(C)C |
| InChI | InChI=1S/C30H48O/c1-25(2)12-7-13-26(3)14-8-15-27(4)16-9-17-28(5)18-10-19-29(6)20-11-21-30-22-23-31-24-30/h14,16,18,20,22-25H,7-13,15,17,19,21H2,1-6H3 |
| InChIKey | OHVSJKPUIYZTFP-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|