C33H48O — CID 89431367
3-[(3E,7E,11E,15E,19E)-4,8,12,16,20-pentamethyltetracosa-3,7,11,15,19-pentaen-23-ynyl]furan (PubChem CID 89431367) has the molecular formula C33H48O and a molecular weight of 460.75 g/mol. Its IUPAC name is 3-[(3E,7E,11E,15E,19E)-4,8,12,16,20-pentamethyltetracosa-3,7,11,15,19-pentaen-23-ynyl]furan.
| Compound Name | 3-[(3E,7E,11E,15E,19E)-4,8,12,16,20-pentamethyltetracosa-3,7,11,15,19-pentaen-23-ynyl]furan |
|---|---|
| PubChem CID | 89431367 |
| Molecular Formula | C33H48O |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.37 |
| IUPAC Name | 3-[(3E,7E,11E,15E,19E)-4,8,12,16,20-pentamethyltetracosa-3,7,11,15,19-pentaen-23-ynyl]furan |
| SMILES | C#CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCc1ccoc1 |
| InChI | InChI=1S/C33H48O/c1-7-8-14-28(2)15-9-16-29(3)17-10-18-30(4)19-11-20-31(5)21-12-22-32(6)23-13-24-33-25-26-34-27-33/h1,15,17,19,21,23,25-27H,8-14,16,18,20,22,24H2,2-6H3/b28-15+,29-17+,30-19+,31-21+,32-23+ |
| InChIKey | RAWLNXAAUDUFPL-IRVXXIIISA-N |
| XLogP | 10.48 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|