C27H38O — CID 123470713
3-(4,8,12,16-tetramethylnonadeca-3,7,11,15-tetraen-18-ynyl)furan (PubChem CID 123470713) has the molecular formula C27H38O and a molecular weight of 378.60 g/mol. Its IUPAC name is 3-(4,8,12,16-tetramethylnonadeca-3,7,11,15-tetraen-18-ynyl)furan.
| Compound Name | 3-(4,8,12,16-tetramethylnonadeca-3,7,11,15-tetraen-18-ynyl)furan |
|---|---|
| PubChem CID | 123470713 |
| Molecular Formula | C27H38O |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 3-(4,8,12,16-tetramethylnonadeca-3,7,11,15-tetraen-18-ynyl)furan |
| SMILES | C#CCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C27H38O/c1-6-11-23(2)12-7-13-24(3)14-8-15-25(4)16-9-17-26(5)18-10-19-27-20-21-28-22-27/h1,12,14,16,18,20-22H,7-11,13,15,17,19H2,2-5H3 |
| InChIKey | JLQNOBQROJDOSM-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|