C33H50O — CID 89431414
3-[(3E,7E,11E,15E,19E)-4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19,21-hexaenyl]furan (PubChem CID 89431414) has the molecular formula C33H50O and a molecular weight of 462.76 g/mol. Its IUPAC name is 3-[(3E,7E,11E,15E,19E)-4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19,21-hexaenyl]furan.
| Compound Name | 3-[(3E,7E,11E,15E,19E)-4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19,21-hexaenyl]furan |
|---|---|
| PubChem CID | 89431414 |
| Molecular Formula | C33H50O |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | 3-[(3E,7E,11E,15E,19E)-4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19,21-hexaenyl]furan |
| SMILES | CC(C)=C/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCc1ccoc1 |
| InChI | InChI=1S/C33H50O/c1-27(2)25-32(7)21-11-19-30(5)17-9-15-28(3)13-8-14-29(4)16-10-18-31(6)20-12-22-33-23-24-34-26-33/h13,16-17,20-21,23-26H,8-12,14-15,18-19,22H2,1-7H3/b28-13+,29-16+,30-17+,31-20+,32-21+ |
| InChIKey | DVKACAMLKILARX-XBBJPQROSA-N |
| XLogP | 11.03 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|