C21H33NOS — CID 155811540
4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]thiomorpholine (PubChem CID 155811540) has the molecular formula C21H33NOS and a molecular weight of 347.57 g/mol. Its IUPAC name is 4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]thiomorpholine.
| Compound Name | 4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]thiomorpholine |
|---|---|
| PubChem CID | 155811540 |
| Molecular Formula | C21H33NOS |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]thiomorpholine |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCN1CCSCC1 |
| InChI | InChI=1S/C21H33NOS/c1-19(8-4-10-21-11-15-23-18-21)6-3-7-20(2)9-5-12-22-13-16-24-17-14-22/h7-8,11,15,18H,3-6,9-10,12-14,16-17H2,1-2H3/b19-8+,20-7+ |
| InChIKey | JCSQOBNZHVQTBE-XVWUSZKISA-N |
| XLogP | 5.71 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|