C20H28O3 — CID 162994880
13-(furan-3-yl)-4-hydroxy-2,6,10-trimethyltrideca-2,6,10-trien-5-one (PubChem CID 162994880) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 13-(furan-3-yl)-4-hydroxy-2,6,10-trimethyltrideca-2,6,10-trien-5-one.
| Compound Name | 13-(furan-3-yl)-4-hydroxy-2,6,10-trimethyltrideca-2,6,10-trien-5-one |
|---|---|
| PubChem CID | 162994880 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 13-(furan-3-yl)-4-hydroxy-2,6,10-trimethyltrideca-2,6,10-trien-5-one |
| SMILES | CC(C)=CC(O)C(=O)C(C)=CCCC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C20H28O3/c1-15(2)13-19(21)20(22)17(4)9-5-7-16(3)8-6-10-18-11-12-23-14-18/h8-9,11-14,19,21H,5-7,10H2,1-4H3 |
| InChIKey | WPDRZTAEVYOWCO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|