C33H52S — CID 123295614
3-(4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19-pentaenyl)thiophene (PubChem CID 123295614) has the molecular formula C33H52S and a molecular weight of 480.85 g/mol. Its IUPAC name is 3-(4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19-pentaenyl)thiophene.
| Compound Name | 3-(4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19-pentaenyl)thiophene |
|---|---|
| PubChem CID | 123295614 |
| Molecular Formula | C33H52S |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 3-(4,8,12,16,20,22-hexamethyltricosa-3,7,11,15,19-pentaenyl)thiophene |
| SMILES | CC(=CCCC(C)=CCCC(C)=CCCc1ccsc1)CCC=C(C)CCC=C(C)CC(C)C |
| InChI | InChI=1S/C33H52S/c1-27(2)25-32(7)21-11-19-30(5)17-9-15-28(3)13-8-14-29(4)16-10-18-31(6)20-12-22-33-23-24-34-26-33/h13,16-17,20-21,23-24,26-27H,8-12,14-15,18-19,22,25H2,1-7H3 |
| InChIKey | JTWGEOQIABTQON-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|