C14H23NS — CID 115708370
6-methyl-N-(2-thiophen-3-ylethyl)hept-5-en-2-amine (PubChem CID 115708370) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is 6-methyl-N-(2-thiophen-3-ylethyl)hept-5-en-2-amine.
| Compound Name | 6-methyl-N-(2-thiophen-3-ylethyl)hept-5-en-2-amine |
|---|---|
| PubChem CID | 115708370 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 6-methyl-N-(2-thiophen-3-ylethyl)hept-5-en-2-amine |
| SMILES | CC(C)=CCCC(C)NCCc1ccsc1 |
| InChI | InChI=1S/C14H23NS/c1-12(2)5-4-6-13(3)15-9-7-14-8-10-16-11-14/h5,8,10-11,13,15H,4,6-7,9H2,1-3H3 |
| InChIKey | XGFREHFAJYLNQQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|