C18H19NOS — CID 61474992
2-[1-(2-thiophen-3-ylethylamino)ethyl]naphthalen-1-ol (PubChem CID 61474992) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-[1-(2-thiophen-3-ylethylamino)ethyl]naphthalen-1-ol.
| Compound Name | 2-[1-(2-thiophen-3-ylethylamino)ethyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 61474992 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[1-(2-thiophen-3-ylethylamino)ethyl]naphthalen-1-ol |
| SMILES | CC(NCCc1ccsc1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C18H19NOS/c1-13(19-10-8-14-9-11-21-12-14)16-7-6-15-4-2-3-5-17(15)18(16)20/h2-7,9,11-13,19-20H,8,10H2,1H3 |
| InChIKey | SBWYLYPLGBWYMX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|