C16H18N4O — CID 64547757
2-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]naphthalen-1-ol (PubChem CID 64547757) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]naphthalen-1-ol.
| Compound Name | 2-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 64547757 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]naphthalen-1-ol |
| SMILES | CC(NCCc1ncn[nH]1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C16H18N4O/c1-11(17-9-8-15-18-10-19-20-15)13-7-6-12-4-2-3-5-14(12)16(13)21/h2-7,10-11,17,21H,8-9H2,1H3,(H,18,19,20) |
| InChIKey | YQTOWAVKSTVYIW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|