C17H20N4 — CID 64547875
N-(1-naphthalen-2-ylethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine (PubChem CID 64547875) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is N-(1-naphthalen-2-ylethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine.
| Compound Name | N-(1-naphthalen-2-ylethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 64547875 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-(1-naphthalen-2-ylethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| SMILES | CC(NCCCc1ncn[nH]1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20N4/c1-13(18-10-4-7-17-19-12-20-21-17)15-9-8-14-5-2-3-6-16(14)11-15/h2-3,5-6,8-9,11-13,18H,4,7,10H2,1H3,(H,19,20,21) |
| InChIKey | WFBMPSUESUQHKA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|