C13H16ClFN4 — CID 64517608
N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine (PubChem CID 64517608) has the molecular formula C13H16ClFN4 and a molecular weight of 282.75 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 64517608 |
| Molecular Formula | C13H16ClFN4 |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| SMILES | CC(NCCCc1ncn[nH]1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClFN4/c1-9(10-4-5-12(15)11(14)7-10)16-6-2-3-13-17-8-18-19-13/h4-5,7-9,16H,2-3,6H2,1H3,(H,17,18,19) |
| InChIKey | TULTUDJKAVZNHK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|