C16H18N4 — CID 64548139
1-naphthalen-2-yl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanamine (PubChem CID 64548139) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-naphthalen-2-yl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanamine.
| Compound Name | 1-naphthalen-2-yl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 64548139 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-naphthalen-2-yl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]ethanamine |
| SMILES | CC(NCCc1ncn[nH]1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H18N4/c1-12(17-9-8-16-18-11-19-20-16)14-7-6-13-4-2-3-5-15(13)10-14/h2-7,10-12,17H,8-9H2,1H3,(H,18,19,20) |
| InChIKey | DLULCAIPTQMCLF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |