C12H17N5O2S — CID 64547537
3-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]benzenesulfonamide (PubChem CID 64547537) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]benzenesulfonamide.
| Compound Name | 3-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64547537 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]benzenesulfonamide |
| SMILES | CC(NCCc1ncn[nH]1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H17N5O2S/c1-9(14-6-5-12-15-8-16-17-12)10-3-2-4-11(7-10)20(13,18)19/h2-4,7-9,14H,5-6H2,1H3,(H2,13,18,19)(H,15,16,17) |
| InChIKey | ANNFFHLMYRGHNA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |