C15H19NS — CID 81375407
(1R)-1-(2-methylphenyl)-N-(2-thiophen-3-ylethyl)ethanamine (PubChem CID 81375407) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is (1R)-1-(2-methylphenyl)-N-(2-thiophen-3-ylethyl)ethanamine.
| Compound Name | (1R)-1-(2-methylphenyl)-N-(2-thiophen-3-ylethyl)ethanamine |
|---|---|
| PubChem CID | 81375407 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (1R)-1-(2-methylphenyl)-N-(2-thiophen-3-ylethyl)ethanamine |
| SMILES | Cc1ccccc1[C@@H](C)NCCc1ccsc1 |
| InChI | InChI=1S/C15H19NS/c1-12-5-3-4-6-15(12)13(2)16-9-7-14-8-10-17-11-14/h3-6,8,10-11,13,16H,7,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | MQNBISABKVJVAH-CYBMUJFWSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |