C12H14BrNS2 — CID 61474936
1-(3-bromothiophen-2-yl)-N-(2-thiophen-3-ylethyl)ethanamine (PubChem CID 61474936) has the molecular formula C12H14BrNS2 and a molecular weight of 316.29 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-(2-thiophen-3-ylethyl)ethanamine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-(2-thiophen-3-ylethyl)ethanamine |
|---|---|
| PubChem CID | 61474936 |
| Molecular Formula | C12H14BrNS2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-(2-thiophen-3-ylethyl)ethanamine |
| SMILES | CC(NCCc1ccsc1)c1sccc1Br |
| InChI | InChI=1S/C12H14BrNS2/c1-9(12-11(13)4-7-16-12)14-5-2-10-3-6-15-8-10/h3-4,6-9,14H,2,5H2,1H3 |
| InChIKey | UGHWZABAYVFTGK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |