C9H14BrNS2 — CID 63981561
1-(3-bromothiophen-2-yl)-N-(2-methylsulfanylethyl)ethanamine (PubChem CID 63981561) has the molecular formula C9H14BrNS2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-(2-methylsulfanylethyl)ethanamine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-(2-methylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 63981561 |
| Molecular Formula | C9H14BrNS2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-(2-methylsulfanylethyl)ethanamine |
| SMILES | CSCCNC(C)c1sccc1Br |
| InChI | InChI=1S/C9H14BrNS2/c1-7(11-4-6-12-2)9-8(10)3-5-13-9/h3,5,7,11H,4,6H2,1-2H3 |
| InChIKey | LFXZOWXCWKGQPJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|