C11H15BrF3NS — CID 113327100
N-[1-(3-bromothiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 113327100) has the molecular formula C11H15BrF3NS and a molecular weight of 330.21 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 113327100 |
| Molecular Formula | C11H15BrF3NS |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | CC(NCCCCC(F)(F)F)c1sccc1Br |
| InChI | InChI=1S/C11H15BrF3NS/c1-8(10-9(12)4-7-17-10)16-6-3-2-5-11(13,14)15/h4,7-8,16H,2-3,5-6H2,1H3 |
| InChIKey | USNNALADRAVMCV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|