C13H23BrN2S — CID 43763214
N-[1-(3-bromothiophen-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 43763214) has the molecular formula C13H23BrN2S and a molecular weight of 319.31 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[1-(3-bromothiophen-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43763214 |
| Molecular Formula | C13H23BrN2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC(C)c1sccc1Br |
| InChI | InChI=1S/C13H23BrN2S/c1-4-16(5-2)9-6-8-15-11(3)13-12(14)7-10-17-13/h7,10-11,15H,4-6,8-9H2,1-3H3 |
| InChIKey | WBPRJZNPWZCHLG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|