C17H23BrN2S — CID 43760716
N'-benzyl-N-[1-(3-bromothiophen-2-yl)ethyl]-N'-methylpropane-1,3-diamine (PubChem CID 43760716) has the molecular formula C17H23BrN2S and a molecular weight of 367.36 g/mol. Its IUPAC name is N'-benzyl-N-[1-(3-bromothiophen-2-yl)ethyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N-[1-(3-bromothiophen-2-yl)ethyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43760716 |
| Molecular Formula | C17H23BrN2S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N'-benzyl-N-[1-(3-bromothiophen-2-yl)ethyl]-N'-methylpropane-1,3-diamine |
| SMILES | CC(NCCCN(C)Cc1ccccc1)c1sccc1Br |
| InChI | InChI=1S/C17H23BrN2S/c1-14(17-16(18)9-12-21-17)19-10-6-11-20(2)13-15-7-4-3-5-8-15/h3-5,7-9,12,14,19H,6,10-11,13H2,1-2H3 |
| InChIKey | PSFDMTQPDHCVBU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|