C10H13BrF3NS — CID 81343374
N-[1-(5-bromothiophen-2-yl)ethyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 81343374) has the molecular formula C10H13BrF3NS and a molecular weight of 316.19 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 81343374 |
| Molecular Formula | C10H13BrF3NS |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(NCCCC(F)(F)F)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H13BrF3NS/c1-7(8-3-4-9(11)16-8)15-6-2-5-10(12,13)14/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | IFRNHXRHBLVWNV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|