C9H10BrF4NS — CID 104579922
N-[1-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 104579922) has the molecular formula C9H10BrF4NS and a molecular weight of 320.15 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 104579922 |
| Molecular Formula | C9H10BrF4NS |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CC(NCC(F)(F)C(F)F)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H10BrF4NS/c1-5(6-2-3-7(10)16-6)15-4-9(13,14)8(11)12/h2-3,5,8,15H,4H2,1H3 |
| InChIKey | ODSSIJCQGSEDBT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|