C10H13F4NO — CID 104578482
2,2,3,3-tetrafluoro-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine (PubChem CID 104578482) has the molecular formula C10H13F4NO and a molecular weight of 239.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104578482 |
| Molecular Formula | C10H13F4NO |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine |
| SMILES | Cc1ccc(C(C)NCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C10H13F4NO/c1-6-3-4-8(16-6)7(2)15-5-10(13,14)9(11)12/h3-4,7,9,15H,5H2,1-2H3 |
| InChIKey | XIUIAAZTUSGPJL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|