C11H13F4NO3 — CID 114169679
methyl 5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]furan-2-carboxylate (PubChem CID 114169679) has the molecular formula C11H13F4NO3 and a molecular weight of 283.22 g/mol. Its IUPAC name is methyl 5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 114169679 |
| Molecular Formula | C11H13F4NO3 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | methyl 5-[1-(2,2,3,3-tetrafluoropropylamino)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C11H13F4NO3/c1-6(16-5-11(14,15)10(12)13)7-3-4-8(19-7)9(17)18-2/h3-4,6,10,16H,5H2,1-2H3 |
| InChIKey | NNLJIQWOVDHPBS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|