C12H16F3NO3 — CID 103261934
methyl 5-[1-(4,4,4-trifluorobutylamino)ethyl]furan-2-carboxylate (PubChem CID 103261934) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is methyl 5-[1-(4,4,4-trifluorobutylamino)ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-(4,4,4-trifluorobutylamino)ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103261934 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 5-[1-(4,4,4-trifluorobutylamino)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NCCCC(F)(F)F)o1 |
| InChI | InChI=1S/C12H16F3NO3/c1-8(16-7-3-6-12(13,14)15)9-4-5-10(19-9)11(17)18-2/h4-5,8,16H,3,6-7H2,1-2H3 |
| InChIKey | VNCARTHNORYESK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|