C12H19NO4 — CID 103230134
methyl 5-[1-(2-ethoxyethylamino)ethyl]furan-2-carboxylate (PubChem CID 103230134) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl 5-[1-(2-ethoxyethylamino)ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-(2-ethoxyethylamino)ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103230134 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl 5-[1-(2-ethoxyethylamino)ethyl]furan-2-carboxylate |
| SMILES | CCOCCNC(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C12H19NO4/c1-4-16-8-7-13-9(2)10-5-6-11(17-10)12(14)15-3/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | NBRVZPXYKGEVDD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|