C13H21NO3S — CID 103266742
methyl 5-[1-(3-methylsulfanylbutylamino)ethyl]furan-2-carboxylate (PubChem CID 103266742) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is methyl 5-[1-(3-methylsulfanylbutylamino)ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-(3-methylsulfanylbutylamino)ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103266742 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl 5-[1-(3-methylsulfanylbutylamino)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NCCC(C)SC)o1 |
| InChI | InChI=1S/C13H21NO3S/c1-9(18-4)7-8-14-10(2)11-5-6-12(17-11)13(15)16-3/h5-6,9-10,14H,7-8H2,1-4H3 |
| InChIKey | KNGFVPIMRSNHMY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |