C13H22N2O3 — CID 103235987
methyl 5-[1-[3-(dimethylamino)propylamino]ethyl]furan-2-carboxylate (PubChem CID 103235987) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 5-[1-[3-(dimethylamino)propylamino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[3-(dimethylamino)propylamino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103235987 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl 5-[1-[3-(dimethylamino)propylamino]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NCCCN(C)C)o1 |
| InChI | InChI=1S/C13H22N2O3/c1-10(14-8-5-9-15(2)3)11-6-7-12(18-11)13(16)17-4/h6-7,10,14H,5,8-9H2,1-4H3 |
| InChIKey | HYINDCFTMZIPLP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|