About methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate
methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate (PubChem CID 106278498) has the molecular formula C14H22N2O4
and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate |
| PubChem CID | 106278498 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate |
| SMILES | CNC(=O)C(C)(C)CNC(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C14H22N2O4/c1-9(16-8-14(2,3)13(18)15-4)10-6-7-11(20-10)12(17)19-5/h6-7,9,16H,8H2,1-5H3,(H,15,18) |
| InChIKey | BHOPDVKWYAPABD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate (CID 106278498) is methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate is CNC(=O)C(C)(C)CNC(C)c1ccc(C(=O)OC)o1.
What is the InChIKey of methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate?
The InChIKey is BHOPDVKWYAPABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O4/c1-9(16-8-14(2,3)13(18)15-4)10-6-7-11(20-10)12(17)19-5/h6-7,9,16H,8H2,1-5H3,(H,15,18).
What are the key properties of methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate?
methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate has a molecular weight of 282.34 g/mol, XLogP of 1.49, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-[[2,2-dimethyl-3-(methylamino)-3-oxopropyl]amino]ethyl]furan-2-carboxylate is sourced from PubChem (CID 106278498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).