C10H17NO2 — CID 103906700
(2R)-1-[1-(5-methylfuran-2-yl)ethylamino]propan-2-ol (PubChem CID 103906700) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2R)-1-[1-(5-methylfuran-2-yl)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[1-(5-methylfuran-2-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 103906700 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2R)-1-[1-(5-methylfuran-2-yl)ethylamino]propan-2-ol |
| SMILES | Cc1ccc(C(C)NC[C@@H](C)O)o1 |
| InChI | InChI=1S/C10H17NO2/c1-7(12)6-11-9(3)10-5-4-8(2)13-10/h4-5,7,9,11-12H,6H2,1-3H3/t7-,9?/m1/s1 |
| InChIKey | SKZRBROREABCCA-YOXFSPIKSA-N |
| XLogP | 1.62 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |