C16H19NO3 — CID 103242341
2-[4-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenyl]acetic acid (PubChem CID 103242341) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[4-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 103242341 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[4-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenyl]acetic acid |
| SMILES | Cc1ccc(C(C)NCc2ccc(CC(=O)O)cc2)o1 |
| InChI | InChI=1S/C16H19NO3/c1-11-3-8-15(20-11)12(2)17-10-14-6-4-13(5-7-14)9-16(18)19/h3-8,12,17H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | WWRJMJOOKXPPDZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |