C13H23NO — CID 43684897
2-methyl-N-[1-(5-methylfuran-2-yl)ethyl]pentan-1-amine (PubChem CID 43684897) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-methyl-N-[1-(5-methylfuran-2-yl)ethyl]pentan-1-amine.
| Compound Name | 2-methyl-N-[1-(5-methylfuran-2-yl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 43684897 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-methyl-N-[1-(5-methylfuran-2-yl)ethyl]pentan-1-amine |
| SMILES | CCCC(C)CNC(C)c1ccc(C)o1 |
| InChI | InChI=1S/C13H23NO/c1-5-6-10(2)9-14-12(4)13-8-7-11(3)15-13/h7-8,10,12,14H,5-6,9H2,1-4H3 |
| InChIKey | XWCBXBGXFJDSHQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |