C14H25NO3 — CID 81093076
3,3-diethoxy-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine (PubChem CID 81093076) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3,3-diethoxy-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine.
| Compound Name | 3,3-diethoxy-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 81093076 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 3,3-diethoxy-N-[1-(5-methylfuran-2-yl)ethyl]propan-1-amine |
| SMILES | CCOC(CCNC(C)c1ccc(C)o1)OCC |
| InChI | InChI=1S/C14H25NO3/c1-5-16-14(17-6-2)9-10-15-12(4)13-8-7-11(3)18-13/h7-8,12,14-15H,5-6,9-10H2,1-4H3 |
| InChIKey | PRLAJXLGJUCLIL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|