C13H23NO2S — CID 81407847
3,3-diethoxy-N-[(1S)-1-thiophen-2-ylethyl]propan-1-amine (PubChem CID 81407847) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 3,3-diethoxy-N-[(1S)-1-thiophen-2-ylethyl]propan-1-amine.
| Compound Name | 3,3-diethoxy-N-[(1S)-1-thiophen-2-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 81407847 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3,3-diethoxy-N-[(1S)-1-thiophen-2-ylethyl]propan-1-amine |
| SMILES | CCOC(CCN[C@@H](C)c1cccs1)OCC |
| InChI | InChI=1S/C13H23NO2S/c1-4-15-13(16-5-2)8-9-14-11(3)12-7-6-10-17-12/h6-7,10-11,13-14H,4-5,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | SNACJCBMBSMFGI-NSHDSACASA-N |
| XLogP | 3.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|