C12H21NS — CID 81398925
2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentan-1-amine (PubChem CID 81398925) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentan-1-amine.
| Compound Name | 2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentan-1-amine |
|---|---|
| PubChem CID | 81398925 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-methyl-N-[(1R)-1-thiophen-2-ylethyl]pentan-1-amine |
| SMILES | CCCC(C)CN[C@H](C)c1cccs1 |
| InChI | InChI=1S/C12H21NS/c1-4-6-10(2)9-13-11(3)12-7-5-8-14-12/h5,7-8,10-11,13H,4,6,9H2,1-3H3/t10?,11-/m1/s1 |
| InChIKey | ZBBAJSSREFWQCU-RRKGBCIJSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |