C12H21NO — CID 81403881
N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpentan-1-amine (PubChem CID 81403881) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpentan-1-amine.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpentan-1-amine |
|---|---|
| PubChem CID | 81403881 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-methylpentan-1-amine |
| SMILES | CCCC(C)CN[C@@H](C)c1ccco1 |
| InChI | InChI=1S/C12H21NO/c1-4-6-10(2)9-13-11(3)12-7-5-8-14-12/h5,7-8,10-11,13H,4,6,9H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | DOWQTSFFUXQHRZ-DTIOYNMSSA-N |
| XLogP | 3.37 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |