C12H21NO3 — CID 81400852
2,2-diethoxy-N-[(1S)-1-(furan-2-yl)ethyl]ethanamine (PubChem CID 81400852) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2,2-diethoxy-N-[(1S)-1-(furan-2-yl)ethyl]ethanamine.
| Compound Name | 2,2-diethoxy-N-[(1S)-1-(furan-2-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81400852 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,2-diethoxy-N-[(1S)-1-(furan-2-yl)ethyl]ethanamine |
| SMILES | CCOC(CN[C@@H](C)c1ccco1)OCC |
| InChI | InChI=1S/C12H21NO3/c1-4-14-12(15-5-2)9-13-10(3)11-7-6-8-16-11/h6-8,10,12-13H,4-5,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | FVVAMVQCTNKMHH-JTQLQIEISA-N |
| XLogP | 2.33 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|