C10H17NO2 — CID 81399975
(1S)-N-(2-ethoxyethyl)-1-(furan-2-yl)ethanamine (PubChem CID 81399975) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (1S)-N-(2-ethoxyethyl)-1-(furan-2-yl)ethanamine.
| Compound Name | (1S)-N-(2-ethoxyethyl)-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 81399975 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (1S)-N-(2-ethoxyethyl)-1-(furan-2-yl)ethanamine |
| SMILES | CCOCCN[C@@H](C)c1ccco1 |
| InChI | InChI=1S/C10H17NO2/c1-3-12-8-6-11-9(2)10-5-4-7-13-10/h4-5,7,9,11H,3,6,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | OWCMKKBNURJSRV-VIFPVBQESA-N |
| XLogP | 1.97 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|