C11H17NO — CID 81400648
N-[(1R)-1-(furan-2-yl)ethyl]-2-methylidenebutan-1-amine (PubChem CID 81400648) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-2-methylidenebutan-1-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-methylidenebutan-1-amine |
|---|---|
| PubChem CID | 81400648 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-methylidenebutan-1-amine |
| SMILES | C=C(CC)CN[C@H](C)c1ccco1 |
| InChI | InChI=1S/C11H17NO/c1-4-9(2)8-12-10(3)11-6-5-7-13-11/h5-7,10,12H,2,4,8H2,1,3H3/t10-/m1/s1 |
| InChIKey | WZQUEFLKQNOZLG-SNVBAGLBSA-N |
| XLogP | 2.90 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|