C12H21NS — CID 83156028
4-methyl-N-[(1S)-1-thiophen-2-ylethyl]pentan-1-amine (PubChem CID 83156028) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 4-methyl-N-[(1S)-1-thiophen-2-ylethyl]pentan-1-amine.
| Compound Name | 4-methyl-N-[(1S)-1-thiophen-2-ylethyl]pentan-1-amine |
|---|---|
| PubChem CID | 83156028 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 4-methyl-N-[(1S)-1-thiophen-2-ylethyl]pentan-1-amine |
| SMILES | CC(C)CCCN[C@@H](C)c1cccs1 |
| InChI | InChI=1S/C12H21NS/c1-10(2)6-4-8-13-11(3)12-7-5-9-14-12/h5,7,9-11,13H,4,6,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | HKLNKDYNOIUQOS-NSHDSACASA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|