C14H25NS — CID 115324978
5-methyl-N-(1-thiophen-2-ylpropyl)hexan-1-amine (PubChem CID 115324978) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 5-methyl-N-(1-thiophen-2-ylpropyl)hexan-1-amine.
| Compound Name | 5-methyl-N-(1-thiophen-2-ylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 115324978 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-methyl-N-(1-thiophen-2-ylpropyl)hexan-1-amine |
| SMILES | CCC(NCCCCC(C)C)c1cccs1 |
| InChI | InChI=1S/C14H25NS/c1-4-13(14-9-7-11-16-14)15-10-6-5-8-12(2)3/h7,9,11-13,15H,4-6,8,10H2,1-3H3 |
| InChIKey | ISLZRWHVCJWURU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|