C15H24ClNO2 — CID 81378294
N-[(1S)-1-(2-chlorophenyl)ethyl]-3,3-diethoxypropan-1-amine (PubChem CID 81378294) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[(1S)-1-(2-chlorophenyl)ethyl]-3,3-diethoxypropan-1-amine.
| Compound Name | N-[(1S)-1-(2-chlorophenyl)ethyl]-3,3-diethoxypropan-1-amine |
|---|---|
| PubChem CID | 81378294 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(1S)-1-(2-chlorophenyl)ethyl]-3,3-diethoxypropan-1-amine |
| SMILES | CCOC(CCN[C@@H](C)c1ccccc1Cl)OCC |
| InChI | InChI=1S/C15H24ClNO2/c1-4-18-15(19-5-2)10-11-17-12(3)13-8-6-7-9-14(13)16/h6-9,12,15,17H,4-5,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | ITVHJYAOPMWCSA-LBPRGKRZSA-N |
| XLogP | 3.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|