C12H19ClN2 — CID 60895776
N'-[1-(2-chlorophenyl)ethyl]butane-1,4-diamine (PubChem CID 60895776) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N'-[1-(2-chlorophenyl)ethyl]butane-1,4-diamine.
| Compound Name | N'-[1-(2-chlorophenyl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 60895776 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-[1-(2-chlorophenyl)ethyl]butane-1,4-diamine |
| SMILES | CC(NCCCCN)c1ccccc1Cl |
| InChI | InChI=1S/C12H19ClN2/c1-10(15-9-5-4-8-14)11-6-2-3-7-12(11)13/h2-3,6-7,10,15H,4-5,8-9,14H2,1H3 |
| InChIKey | SVNWWENYEHAMBP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|