C15H24ClN — CID 114209435
N-[(1S)-1-(2-chlorophenyl)ethyl]-4,4-dimethylpentan-1-amine (PubChem CID 114209435) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is N-[(1S)-1-(2-chlorophenyl)ethyl]-4,4-dimethylpentan-1-amine.
| Compound Name | N-[(1S)-1-(2-chlorophenyl)ethyl]-4,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114209435 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[(1S)-1-(2-chlorophenyl)ethyl]-4,4-dimethylpentan-1-amine |
| SMILES | C[C@H](NCCCC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C15H24ClN/c1-12(13-8-5-6-9-14(13)16)17-11-7-10-15(2,3)4/h5-6,8-9,12,17H,7,10-11H2,1-4H3/t12-/m0/s1 |
| InChIKey | BTILBBWFJWVKOL-LBPRGKRZSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|