C10H14Cl2N2 — CID 129414495
N'-[(1S)-1-(2,3-dichlorophenyl)ethyl]ethane-1,2-diamine (PubChem CID 129414495) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is N'-[(1S)-1-(2,3-dichlorophenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[(1S)-1-(2,3-dichlorophenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 129414495 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N'-[(1S)-1-(2,3-dichlorophenyl)ethyl]ethane-1,2-diamine |
| SMILES | C[C@H](NCCN)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-7(14-6-5-13)8-3-2-4-9(11)10(8)12/h2-4,7,14H,5-6,13H2,1H3/t7-/m0/s1 |
| InChIKey | GXADVKKFZVKWOC-ZETCQYMHSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |